DENV-IN-5
DENV-IN-5 (Compound 4b) is a dengue virus (DENV) inhibitor with EC50s of 1.47, 9.23, 7.08 and 8.91 μM against DENV-I - IV replication, respectively. DENV-IN-5 also inhibits HIV-1IIIB strain with an EC50 of 0.1512 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2762302-75-8 |
| Pricing | Inquire |
| Cas | 2762302-75-8 |
| Molecular Weight | 516.66 |
| Molecular Formula | C23H25ClF2N4OS |
| Canonical SMILES | CCC1=C(N=C(NC1=O)SCC2=C(C(=NN2)C3=CC(=C(C=C3)F)F)Cl)CC4CCCCC4 |