Acetyl-L-carnitine
Acetyl-L-carnitine (ALC or ALCAR) is a naturally occurring compound that plays a crucial role in energy metabolism. ALC is often used as a supplement to improve cognitive function, memory, and mental clarity. It is investigated for its potential benefits in conditions like Alzheimer's disease and age-related cognitive decline. ALC may help reduce symptoms of neuropathic pain, which is pain caused by nerve damage. It is studied for conditions such as diabetic neuropathy. It is sometimes used to combat fatigue, particularly in chronic fatigue syndrome and fibromyalgia. ALC may improve sperm quality and motility, potentially aiding in the treatment of male infertility. Acetyl-L-carnitine is a versatile supplement with potential benefits for cognitive health, neuropathic pain, energy production, and more. Its role in mitochondrial function and neuroprotection makes it a valuable compound for various therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3040-38-8 |
| Pricing | Inquire |
| Cas | 3040-38-8 |
| Molecular Weight | 203.24 |
| Molecular Formula | C9H17NO4 |
| Canonical SMILES | CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |