(E)-GABAB receptor antagonist 1
(E)-GABAB receptor antagonist 1, a trans-GABAB receptor antagonist 1, reduces the maximum effect of agonist GABA-induced IP3 (inositol trisphosphate) production (IC50 = 37.9 μM) in HEK293 cells overexpressing GABAB receptors and Gqi9 proteins without altering EC50.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1611483-29-4 |
| Pricing | Inquire |
| Cas | 1611483-29-4 |
| Molecular Weight | 304.38 |
| Molecular Formula | C18H24O4 |
| Canonical SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=CC(=O)C(=O)O |