2',3',5'-Tri-O-acetyl-6-S-methyl-6-thio-guanosine
2',3',5'-Tri-O-acetyl-6-S-methyl-6-thio-guanosine, a nucleoside analog, has been extensively studied for its efficacy in disrupting viral RNA synthesis and inhibiting the replication of Hepatitis C Virus (HCV). Furthermore, promising research suggests its potential utility as a treatment option for certain malignant neoplasms, such as leukemia and lymphoma.
| Supplier | BOC Sciences |
|---|---|
| Product # | 80681-58-9 |
| Pricing | Inquire |
| Cas | 80681-58-9 |
| Molecular Weight | 439.44 |
| Molecular Formula | C17H21N5O7S |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=NC3=C2N=C(N=C3SC)N)OC(=O)C)OC(=O)C |