GR 94800
| Supplier | Creative Peptides |
|---|---|
| Product # | R1021 |
| CAS # | 141636-65-9 |
| Pricing | Inquire |
| LabelingTarget | NK2 Receptors |
| BoilingPoint | 1310.4ºC at 760 mmHg |
| Synonyms | N-Benzoyl-L-alanyl-L-alanyl-D-tryptophyl-L-phenylalanyl-D-prolyl-L-prolyl-L-norleucinamide |
| MolecularFormula | C49H61N9O8 |
| MolecularWeight | 904.08 |
| Source | Synthetic |
| Sequence | AAWFPPX(Modifications: Ala-1 = N-(Bz)Ala, Trp-3 = D-Trp, Pro-5 = D-Pro, X = Nle with C-terminal amide) |
| Storage | -20°C |
| Explanation | GR94800 is extremely potent and selective NK-2 receptor antagonist. |
| Activity | Antagonist |
| InChI | InChI=1S/C49H61N9O8/c1-4-5-21-37(42(50)59)54-47(64)40-23-14-25-57(40)49(66)41-24-15-26-58(41)48(65)39(27-32-16-8-6-9-17-32)56-46(63)38(28-34-29-51-36-22-13-12-20-35(34)36)55-44(61)31(3)52-43(60)30(2)53-45(62)33-18-10-7-11-19-33/h6-13,16-20,22,29-31,37-41,51H,4-5,14-15,21,23-28H2,1-3H3,(H2,50,59)(H,52,60)(H,53,62)(H,54,64)(H,55,61)(H,56,63)/t30-,31-,37-,38+,39-,40-,41+/m0/s1 |
| InChIKey | CWEISCOCKRHHOU-UJYVDGJVSA-N |
| IsomericSMILES | CCCC[C@@H](C(=O)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H]2CCCN2C(=O)[C@H](CC3=CC=CC=C3)NC(=O)[C@@H](CC4=CNC5=CC=CC=C54)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)C6=CC=CC=C6 |
| Purity | >98% |