Methyl 6-O-Trityl-D-galactopyranoside
Methyl 6-O-Trityl-D-galactopyranoside, an essential biomedicine asset, proves invaluable in scientific research pertaining to drug discovery and development. Its multifaceted utility as a building block in synthesizing diverse pharmaceutical compounds grants it prominence. Profoundly, it assumes the role of a precursor, offering profound prospects for targeted therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35780-80-4 |
| Pricing | Inquire |
| Cas | 35780-80-4 |
| Molecular Weight | 436.50 |
| Molecular Formula | C26H28O6 |
| Canonical SMILES | COC1C(C(C(C(O1)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O)O)O |