3',5'-Bis(O-t-butyldimethylsilyl)-4'-C-hydroxymethyl thymidine
compound: 3',5'-Bis(O-t-butyldimethylsilyl)-4'-C-hydroxymethyl thymidine is an indispensable harbinger in the realm of biomedicine, resolutely illuminating the nuances of DNA synthesis and transcription. Its utility lies in the realm of synthesizing modified nucleoside analogs, thereby unraveling the intricate tapestry of DNA replication and repair mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 179178-45-1 |
| Pricing | Inquire |
| Cas | 179178-45-1 |
| Molecular Weight | 500.78 |
| Molecular Formula | C23H44N2O6Si2 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)(CO)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |