Viranamycin B
It is produced by the strain of Str. sp. CH 41. It can inhibit the growth of murine leukemia cell P388 with IC50 of 2.8 ng/mL, and it can also inhibit KB human multi-squamous cell carcinoma cells with IC50 of 1.9 ng/mL.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02965 |
| Pricing | Inquire |
| Cas | 139595-04-3 |
| Molecular Weight | 840.05 |
| Molecular Formula | C44H73NO14 |
| Canonical SMILES | CCC1C(C(CC(=CC=CC(C(OC(=O)C(=CC(=CC(C1O)C)C)OC)C(C)C(C(C)C2(CC(C(C(O2)C)C)OC3CC(C(C(O3)C)OC(=O)N)O)O)O)OC)C)C)O |