Ethacrynic acid-[d5]
Ethacrynic acid-[d5] is the labelled analogue of Ethacrynic acid. Ethacrynic acid is a loop diuretic used to treat high blood pressure and the swelling caused by diseases like congestive heart failure, liver failure, and kidney failure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012344 |
| Pricing | Inquire |
| Cas | 1330052-59-9 |
| Molecular Weight | 308.17 |
| Molecular Formula | C13H7D5Cl2O4 |
| Canonical SMILES | CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)O)Cl)Cl |