MAGE-1 Antigen (161-169) (human)
MAGE-1 Antigen (161-169) (human) is a truncated fragment of MAGE-1 which is a gene that encodes an antigen on a melanoma cell line. MAGE-1 is expressed by melanoma tissue from all stages of disease, but not melanocytes, nevus tissue, or any normal diploid cell line tested.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010690 |
| Pricing | Inquire |
| Cas | 144449-86-5 |
| Molecular Weight | 975.95 |
| Molecular Formula | C41H57N11O17 |
| Canonical SMILES | CC(C(C(=O)NCC(=O)NC(CC1=CN=CN1)C(=O)NC(CO)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)O)NC(=O)C3CCCN3C(=O)C(CC(=O)O)NC(=O)C(C)NC(=O)C(CCC(=O)O)N)O |