α-D-Glucose 1,6-diphosphate
α-D-Glucose 1,6-diphosphate is a pivotal metabolic intermediate extensively employed in the biomedical sector—represents an indispensable substrate, instrumental in the generation of ATP within the glycolysis pathway. Nurturing cellular energy replenishment, it assumes a vital position in studying glycogen storage maladies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10139-18-1 |
| Pricing | Inquire |
| Cas | 10139-18-1 |
| Molecular Weight | 340.12 |
| Molecular Formula | C6H14O12P2 |
| Canonical SMILES | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)OP(=O)(O)O |