2-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside is an indispensable compound within the realm of compound, finding assuming a pivotal role as an intermediary in the research and development of antibiotics, antiviral substances, and glycosylation restrainers.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13264-92-1 |
| Pricing | Inquire |
| Cas | 13264-92-1 |
| Molecular Weight | 342.3 |
| Molecular Formula | C14H18N2O8 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC=C2[N+](=O)[O-])CO)O)O |