Enaminomycin A
It is produced by the strain of Streptomyces baarnensis 13120. It has activity against gram-positive bacteria, gram-negative bacteria and plant pathogenic fungi (weak), and it has the inhibitory effect of L-1210.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01224 |
| Pricing | Inquire |
| Cas | 68330-49-4 |
| Molecular Weight | 183.12 |
| Molecular Formula | C7H5NO5 |
| Canonical SMILES | C12C(O1)C(=O)C(=N)C(=C2O)C(=O)O |