SR 33805 oxalate
SR 33805 oxalate is a potent Ca2+ channel antagonist that binds allosterically to the a1-subunit of L-type Ca2+ channels (Kd = 20 pM). SR 33805 displays selectivity for vascular smooth muscle, inducing vasorelaxation with no inotropic or chronotropic effects. It exhibits an inhibitory effect on PDGF-stimulated smooth muscle cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121346-33-6 |
| Pricing | Inquire |
| Cas | 121346-33-6 |
| Molecular Weight | 654.77 |
| Molecular Formula | C32H40N2O5S.C2H2O4 |
| Canonical SMILES | CC(C)C1=C(N(C2=CC=CC=C21)C)S(=O)(=O)C3=CC=C(C=C3)OCCCN(C)CCC4=CC(=C(C=C4)OC)OC.C(=O)(C(=O)O)O |