4-Hydroxyestradiol-3-O-b-D-glucuronide
4-Hydroxyestradiol-3-O-b-D-glucuronide is a paradigmatic compound renowned in the scientific realm, emerging as an indispensably formidable estrogen metabolite bestowed with paramount importance in the pivotal biomedical industry. Prized for its profound utility in research endeavors, this compound efficaciously unravels the enigma enshrouding estrogen metabolism and its multifarious ramifications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 90746-94-4 |
| Pricing | Inquire |
| Cas | 90746-94-4 |
| Molecular Weight | 464.51 |
| Molecular Formula | C24H32O9 |
| Canonical SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4O)OC5C(C(C(C(O5)C(=O)O)O)O)O |