Methyl 3-O-benzyl-b-D-xylopyranoside
Methyl 3-O-benzyl-b-D-xylopyranoside is an indispensable chemical compound in the biomedical sector, exhibiting multifaceted applications in the primordial precursor for drug and pharmaceutical synthesis. In the realm of scientific investigation, it serves as a splendid tool to unravel the intricate involvement of carbohydrates in vital biological phenomena, thereby fostering the development of afflictions such as cancer and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72521-39-2 |
| Pricing | Inquire |
| Cas | 72521-39-2 |
| Molecular Weight | 254.28 |
| Molecular Formula | C13H18O5 |
| Canonical SMILES | COC1C(C(C(CO1)O)OCC2=CC=CC=C2)O |