4-O-(b-D-Galactopyranosyl)-D-galactopyranose
4-O-(b-D-Galactopyranosyl)-D-galactopyranose, an indispensable compound in the field of biomedicine, serves as a cornerstone for targeted drug delivery and the advancement of therapeutics. Its significance lies in the management of ailments associated with irregular glycosylation, particularly lysosomal storage disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2152-98-9 |
| Pricing | Inquire |
| Cas | 2152-98-9 |
| Molecular Weight | 342.29 |
| Molecular Formula | C12H22O11 |
| Canonical SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |