Glabrescione B
Glabrescione B is the first compound to bind the Hedgehog (Hh) modulator Gli1 and impair its activity by interfering with Gli1-DNA interaction. It inhibits the growth of Hedgehog-dependent tumor cells, the self-renewal ability, and clonogenicity of tumor-derived stem cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65893-94-9 |
| Pricing | Inquire |
| Cas | 65893-94-9 |
| Molecular Weight | 450.52 |
| Molecular Formula | C27H30O6 |
| Canonical SMILES | CC(=CCOC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=CC(=C3)OC)OC)OCC=C(C)C)C |