Leukadherin-1
Leukadherin-1, also known as LA1, is a small molecule agonist that enhances CD11b/CD18-dependent cell adhesion to its ligand ICAM-1. Leukadherin-1 suppresses human innate inflammatory signalling. leukadherin-1 increases CD11b/CD18-dependent adhesion via membrane tethers. It also competitively inhibits YopH (Ki = 1.94 µM), a tyrosine phosphorylase secreted by Y. pestis into immune cells to block signal transduction, and anthrax lethal factor metalloproteinase, a component of anthrax toxin (IC50 = 6 µM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 344897-95-6 |
| Pricing | Inquire |
| Cas | 344897-95-6 |
| Molecular Weight | 421.48 |
| Molecular Formula | C22H15NO4S2 |
| Canonical SMILES | O=C(O)C1=CC=C(C2=CC=C(/C=C(SC(N3CC4=CC=CC=C4)=S)/C3=O)O2)C=C1 |