Gentamicin C2
It is an aminoglycoside antibiotic produced by the strain of Micromonospora spp. One of several components of the gentamicin C complex which can comprise 25-55% gentamicin depending on the manufacturer or manufacturing process.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04435 |
| Pricing | Inquire |
| Cas | 25876-11-3 |
| Molecular Weight | 463.57 |
| Molecular Formula | C20H41N5O7 |
| Canonical SMILES | CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)N |