Brivudine 5'-Monophosphate
Brivudine 5'-Monophosphate is a hetero-dinucleotide that acts as an anti-tumor agent against AH13 rat sarcoma cells. A nucleotide derivative which is an active species of the novel anticancer drug, NB 1011. Anti-viral.
| Supplier | BOC Sciences |
|---|---|
| Product # | 80860-82-8 |
| Pricing | Inquire |
| Cas | 80860-82-8 |
| Molecular Weight | 413.12 |
| Molecular Formula | C11H14BrN2O8P |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)C=CBr)COP(=O)(O)O)O |