Neuropeptide S (Rat)
Neuropeptide S, a neuropeptide that plays a major role in regulating sleep and stress, is a potent endogenous neuropeptide S receptor (NSPR) agonist (EC50 = 3.2 nM for inducing intracellular calcium mobilization in HEK293 cells expressing the human receptor). It enhances memory during the consolidation phase and interacts with noradrenergic systems in the brain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 412938-75-1 |
| Pricing | Inquire |
| Cas | 412938-75-1 |
| Molecular Weight | 2210.52 |
| Molecular Formula | C95H160N34O27 |
| Canonical SMILES | CC(C)C(C(=O)NCC(=O)NC(CO)C(=O)NCC(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)NC(CO)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)N)C(=O)O)NC(=O)CNC(=O)C(CC(=O)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CO)N |