Gastrodin Impurity 1
Gastrodin Impurity 1 is a vital product in the biomedical industry used as an impurity reference standard for the analysis of Gastrodin, a natural compound found in the herb Gastrodia elata. Gastrodin has shown potential in studying neurological disorders, such as Alzheimer's disease, possesses antioxidative and anti-inflammatory properties. Gastrodin Impurity 1 plays a crucial role in ensuring accurate analysand quality control of Gastrodin-based drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP5191 |
| Pricing | Inquire |
| Cas | 26993-16-8 |
| Molecular Weight | 284.26 |
| Molecular Formula | C13H16O7 |
| Canonical SMILES | C1=CC(=CC=C1C=O)OC2C(C(C(C(O2)CO)O)O)O |