Octanoyl b-D-glucosylamine
Octanoyl b-D-glucosylamine is a biomedical product used to treat insulin resistance, a condition commonly associated with type 2 diabetes. This compound, derived from glucose, has potential therapeutic effects in regulating blood glucose levels and improving insulin sensitivity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 134403-86-4 |
| Pricing | Inquire |
| Cas | 134403-86-4 |
| Molecular Weight | 305.37 |
| Molecular Formula | C14H27NO6 |
| Canonical SMILES | CCCCCCCC(=O)NC1C(C(C(C(O1)CO)O)O)O |