(3R)-Hydroxyquinine-[d3]
(3R)-Hydroxyquinine-[d3] is the labelled enantiomer of (3S)-3-Hydroxy Quinidine. (3S)-3-Hydroxy Quinidine is the major metabolite of the Cinchona alkaloid Quinidine. Quinidine is a class I antiarrhythmic agent. It is a stereoisomer of Quinine, originally derived from the bark of the cinchona tree.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007909 |
| Pricing | Inquire |
| Molecular Weight | 343.43 |
| Molecular Formula | C20H21D3N2O3 |
| Canonical SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4(C=C)O)O |