Oxyresveratrol 2-O-β-D-glucopyranoside
Oxyresveratrol 2-O-β-D-glucopyranoside is a derivative of Resveratrol. Resveratrol is a stilbenoid, a type of natural phenol, and a phytoalexin produced by several plants in response to injury or, when the plant is under attack by pathogens such as bacteria or fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1821-053447 |
| Pricing | Inquire |
| Cas | 392274-22-5 |
| Molecular Weight | 406.387 |
| Molecular Formula | C20H22O9 |
| Canonical SMILES | C1=CC(=C(C=C1O)OC2C(C(C(C(O2)CO)O)O)O)C=CC3=CC(=CC(=C3)O)O |