Coumarin Boronic Acid pinacolate ester
Coumarin boronic acid pinacolate ester (CBE) is an ester form of coumarin boronic acid (CBA) with better solubility. It can be used to detect peroxynitrite, hypochlorous acid and hydrogen peroxide.
| Supplier | BOC Sciences |
|---|---|
| Product # | 190788-61-5 |
| Pricing | Inquire |
| Cas | 190788-61-5 |
| Molecular Weight | 272.1 |
| Molecular Formula | C15H17BO4 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CC(=O)O3 |