2-Oxo-2-[[4-(trifluoromethyl)phenyl]amino]acetic Acid Ethyl Ester
2-Oxo-2-[[4-(trifluoromethyl)phenyl]amino]acetic Acid Ethyl Ester, is an intermediate for the synthesis of 2-Oxo-2-[[4-(trifluoromethyl)phenyl]amino]acetic Acid (O865080). It can also be used for the preparation of Oxanilates derivatives, used as chemical hybridizing agents for Wheat (Triticum aestivum L.).
| Supplier | BOC Sciences |
|---|---|
| Product # | BB076464 |
| Pricing | Inquire |
| Cas | 69066-00-8 |
| Molecular Weight | 261.2 |
| Molecular Formula | C11H10F3NO3 |
| Canonical SMILES | CCOC(=O)C(=O)NC1=CC=C(C=C1)C(F)(F)F |