TASIN-1 hydrochloride
TASIN-1 Hydrochloride is a truncated APC selective inhibitor. It works by selectively killing colorectal cancer cells that express truncated APC by reducing cellular cholesterol levels and inducing apoptotic cell death through the ER stress/ROS/JNK signaling in colon cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1678515-13-3 |
| Pricing | Inquire |
| Cas | 1678515-13-3 |
| Molecular Weight | 388.95 |
| Molecular Formula | C18H29ClN2O3S |
| Canonical SMILES | CC1CCN(CC1)C2CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)OC.Cl |