Ezetimibe Phenoxy Glucuronide-[d4]
Ezetimibe Phenoxy Glucuronide-[d4] is the labelled analogue of Ezetimibe Phenoxy Glucuronide, which is a metabolite of Ezetimibe. Ezetimibe is a medication used to treat high blood cholesterol and certain other lipid abnormalities. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L1) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005427 |
| Pricing | Inquire |
| Cas | 1426174-41-5 |
| Molecular Weight | 589.57 |
| Molecular Formula | C30H25D4F2NO9 |
| Canonical SMILES | C1=CC(=CC=C1C2C(C(=O)N2C3=CC=C(C=C3)F)CCC(C4=CC=C(C=C4)F)O)OC5C(C(C(C(O5)C(=O)O)O)O)O |