2,3-Dihydro-5-furylboronic acid pinacol ester
2,3-Dihydro-5-furylboronic acid pinacol ester is an intermediate used in synthetic chemistry for biomedical applications. It plays a significant role in the manufacture of various pharmaceutical drugs, especially those directed towards treating cancer and cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1046812-02-5 |
| Pricing | Inquire |
| Cas | 1046812-02-5 |
| Molecular Weight | 196.1 |
| Molecular Formula | C10H17BO3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCCO2 |