Hyptadienic acid
Hyptadienic acid isolated from the plant extract exhibited moderate cytotoxicity against HepG2 cells. Hyptadienic acid is the active principles responsible for the cytotoxicity against three cultured human tumor cell lines, HL-60 (leukemia carcinoma), MCF-7 (breast carcinoma), and Hep-G2 (hepatic carcinoma), with half maximal inhibitory concentration (IC50) values of 12-48 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6730 |
| Pricing | Inquire |
| Cas | 128397-09-1 |
| Molecular Weight | 470.7 |
| Molecular Formula | C30H46O4 |
| Canonical SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(C(=CC5(C)C)CO)C)C)C2C1(C)O)C)C(=O)O |