6-(Furan-2-yl)purine-beta-D-(3'-deoxy-3'-fluoro)riboside
6-(Furan-2-yl)purine-beta-D-(3'-deoxy-3'-fluoro)riboside is a highly efficacious antiviral compound, finding significant utility within the biomedical sphere for research of viral infections. By impeding viral replication and dissemination, it attenuates the deleterious manifestations associated with these infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612191-89-5 |
| Pricing | Inquire |
| Cas | 1612191-89-5 |
| Molecular Weight | 320.28 |
| Molecular Formula | C14H13FN4O4 |
| Canonical SMILES | C1=COC(=C1)C2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)F)O |