Ioflubenzamide I-131
Ioflubenzamide I-131 is an iodine 131-radiolabeled small-molecule benzamide compound with potential antineoplastic activity. The benzamide moiety of ioflubenzamide I-131 binds to melanin, selectively delivering a cyotoxic dose of gamma and beta radiation to melanin-expressing tumor cells. Melanin pigments, polymer derivatives of the amino acid tyrosine, are over-expressed in approximately 40% of melanomas.
| Supplier | BOC Sciences |
|---|---|
| Product # | 864462-68-0 |
| Pricing | Inquire |
| Cas | 864462-68-0 |
| Molecular Weight | 517.35 |
| Molecular Formula | C21H25F131IN3O3 |
| Canonical SMILES | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)NC(=O)C2=CC=C(C=C2)F)I |