2-Deoxy-D-glucose-6-phosphate sodium salt
2-Deoxy-D-glucose-6-phosphate sodium salt, an indispensable compound in the field of biomedicine, exhibits its vital role as a metabolic inhibitor by effectively impeding glycolysis through competitive inhibition of glucose uptake. With its remarkable ability to disrupt crucial energy processes in diseased cells, the compound shows immense potential in combating a wide range of illnesses such as cancers and viral infections.
Supplier | BOC Sciences |
---|---|
Product # | 33068-19-8 |
Pricing | Inquire |
Cas | 33068-19-8 |
Molecular Weight | 266.12 |
Molecular Formula | C6H12NaO8P |
Canonical SMILES | C(C=O)C(C(C(COP(=O)(O)O)O)O)O.[Na] |