2',3'-Dideoxy-2'-fluorouridine
2',3'-Dideoxy-2'-fluorouridine, an imperative compound in the field of biomedicine, exhibits significant antiviral efficacy. Renowned for its distinguished properties, this product finds extensive application in combating viral infections, specifically those prompted by HIV and hepatitis B. By effectively impeding the proliferation and replication of these viruses, it presents promising therapeutic prospects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 122929-22-0 |
| Pricing | Inquire |
| Cas | 122929-22-0 |
| Molecular Weight | 230.19 |
| Molecular Formula | C9H11FN2O4 |
| Canonical SMILES | C1C(OC(C1F)N2C=CC(=O)NC2=O)CO |