Enrofloxacin-[d5] Hydroiodide
Enrofloxacin-[d5] Hydroiodide is the labelled analogue of Enrofloxacin Hydroiodide, which is a derivative of Enrofloxacin.
Enrofloxacin is a fluoroquinolone antibiotic used for the treatment of individual pets and domestic animals.
Enrofloxacin is a fluoroquinolone antibiotic used for the treatment of individual pets and domestic animals.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012913 |
| Pricing | Inquire |
| Cas | 1219795-24-0 |
| Molecular Weight | 492.34 |
| Molecular Formula | C19H17D5FN3O3.HI |
| Canonical SMILES | CCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)F.I |