SMK-17
SMK-17 is a MEK1/2 inhibitor. It can inhibit MEK1 kinase activity in a non-ATP-competitive manner and it is highly selective to MEK1 and 2. SMK-17 can inhibit the growth of tumor cell lines in vitro. But it did not inhibit the phosphorylation of ERK5. SMK-17 selectively blocked the MAPK pathway signaling without affecting other signal pathways, which resulted in significant antitumor efficacy without notable side effects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 765958-29-0 |
| Pricing | Inquire |
| Cas | 765958-29-0 |
| Molecular Weight | 584.85 |
| Molecular Formula | C20H24ClF2IN4O2S |
| Canonical SMILES | O=S(N1CCC(NC(C)C)CC1)(NC2=CC=C(F)C(F)=C2NC3=CC=C(I)C=C3Cl)=O |