Cytidine 5'-triphosphate
Cytidine 5'-triphosphate is a vital molecule in biomedicine that serves as a building block for DNA and RNA synthesis. It plays a crucial role in cellular processes, such as cell growth, proliferation, and signal transduction. Cytidine 5'-triphosphate is used in the treatment of certain viral infections and cancer where it acts as an antiviral and antineoplastic agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65-47-4 |
| Pricing | Inquire |
| Cas | 65-47-4 |
| Molecular Weight | 483.16 |
| Molecular Formula | C9H16N3O14P3 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |