2',3'-cGAMP sodium salt
2',3'-cGAMP sodium is an endogenous cGAMP in mammalian cells. 2',3'-cGAMP sodium binds to STING with a high affinity and is a potent inducer of interferon-β. 2',3'-cGAMP is an effective adjuvant that boosts the production of antigen-specific antibodies and T cell responses in mice.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2734858-36-5 |
| Pricing | Inquire |
| Cas | 2734858-36-5 |
| Molecular Weight | 718.38 |
| Molecular Formula | C20H22N10Na2O13P2 |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=C(NC4=O)N)OP(=O)(OCC5C(C(C(O5)N6C=NC7=C(N=CN=C76)N)O)OP(=O)(O1)[O-])[O-])O.[Na+].[Na+] |