Valganciclovir HCl
Valganciclovir hydrochloride hydrate is an antiviral used to treat cytomegalovirus infection. It is the prodrug of ganciclovir, a synthetic analog of 2'-deoxy-guanosine which is phosphorylated to a dGTP analog that competitively inhibits the incorporation of dGTP by viral DNA polymerase.
Supplier | BOC Sciences |
---|---|
Product # | B0084-061144 |
Pricing | Inquire |
Cas | 175865-59-5 |
Molecular Weight | 390.82 |
Molecular Formula | C14H23ClN6O5 |
Canonical SMILES | CC(C)C(C(=O)OCC(CO)OCN1C=NC2=C1NC(=NC2=O)N)N.Cl |