Rosuvastatin EP Impurity B (SS-Isomer)
Rosuvastatin EP Impurity B (SS-Isomer) is an impurity of Rosuvastatin, which is a statin medication used to prevent cardiovascular disease in those at high risk and treat abnormal lipids.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1584149-34-7 |
| Pricing | Inquire |
| Cas | 1584149-34-7 |
| Molecular Weight | 481.54 |
| Molecular Formula | C22H28FN3O6S |
| Canonical SMILES | CC(C)C1=NC(=NC(=C1C=CC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)N(C)S(=O)(=O)C |