1,2,3,4-Tetra-o-acetyl-alpha-d-arabinopyranose
1,2,3,4-Tetra-o-acetyl-alpha-d-arabinopyranose, a compound of immense significance in the biomedical sector, is characterized by its fundamental role in the domain of pharmaceutical research and development. Derived from arabinose, this invaluable product serves as a pivotal precursor for the synthesis of diverse drugs and therapies employed in combating infectious diseases, namely HIV/AIDS.
| Supplier | BOC Sciences |
|---|---|
| Product # | 108646-05-5 |
| Pricing | Inquire |
| Cas | 108646-05-5 |
| Molecular Weight | 318.28 |
| Molecular Formula | C13H18O9 |
| Canonical SMILES | CC(=O)OC1COC(C(C1OC(=O)C)OC(=O)C)OC(=O)C |