1-Butyl-2,3-dimethyl-3-imidazolium Chloride
1-Butyl-2,3-dimethylimidazolium chloride can be used as a solvent in the chemical modification of polysaccharide cellulose. It also can be used to prepare mesoporous ZnAl2O4 nanomaterials, which are used as catalysts or catalyst supports.
Supplier | BOC Sciences |
---|---|
Product # | BB042225 |
Pricing | Inquire |
Cas | 98892-75-2 |
Molecular Weight | 188.70 |
Molecular Formula | C9H17ClN2 |
Canonical SMILES | CCCCN1C=C[N+](=C1C)C.[Cl-] |