2,4,7,8,9-Penta-O-acetyl-N-azidoacetyl-b-neuraminic acid methyl ester
2,4,7,8,9-Penta-O-acetyl-N-azidoacetyl-b-neuraminic acid methyl ester, an indispensable biomedical compound, demonstrates exceptional proficiency in synthesizing and refining antiviral pharmaceuticals. Its paramount significance manifests in effectively combating an array of virus-induced infections, namely influenza and herpes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1357804-21-7 |
| Pricing | Inquire |
| Cas | 1357804-21-7 |
| Molecular Weight | 574.49 |
| Molecular Formula | C22H30N4O14 |
| Canonical SMILES | [N-]=[N+]=NCC(=O)NC1C(OC(=O)C)CC(OC(=O)C)(OC1C(OC(=O)C)C(OC(=O)C)COC(=O)C)C(=O)OC |