2'-C-Methylcytidine
A nucleoside analog with anti-hepatitis C virus (HCV) activity. Upon phosphorylation into its 5-triphosphate form, this metabolite inhibits viral RNA chain elongation and viral RNA-dependent RNA polymerase activity. This blocks viral production of HCV RNA and thus viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20724-73-6 |
| Pricing | Inquire |
| Cas | 20724-73-6 |
| Molecular Weight | 257.24 |
| Molecular Formula | C10H15N3O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=CC(=NC2=O)N)CO)O)O |