Protosappanin B
Protosappanin B is a natural compound found in the heart wood of Caesalpinia sappan L. Protosappanin B exhibits antitumor and anti-oxidant activity that can inhibit the oxidation of linoleic acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4585 |
| Pricing | Inquire |
| Cas | 102036-29-3 |
| Molecular Weight | 304.30 |
| Molecular Formula | C16H16O6 |
| Canonical SMILES | C1C2=CC(=C(C=C2C3=C(C=C(C=C3)O)OCC1(CO)O)O)O |