4-Methyl-3-nitrobenzenesulfonamide
4-Methyl-3-nitrobenzenesulfonamide (CAS# 6949-23-1) is an intermediate used to prepare α-keto amide inhibitors of hepatitis C virus NS3 protease. It is also used to synthesize 1,4-diazepane-3,5-dione derivs. for prevention and treatment of various diseases associated with chymase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6949-23-1 |
| Pricing | Inquire |
| Cas | 6949-23-1 |
| Molecular Weight | 216.21 |
| Molecular Formula | C7H8N2O4S |
| Canonical SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N)[N+](=O)[O-] |