7-Hydroxy-4'-methoxyflavone
7-Hydroxy-4'-methoxyflavone is a highly potent and extensively utilized natural flavonoid compound within the biomedical sector, demonstrating profound antioxidant, anti-inflammatory and antiviral properties, rendering it indispensable in the formulation and development of therapeutic agents targeting a wide array of ailments encompassing cancer, cardiovascular maladies and neurodegenerative disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 487-24-1 |
| Pricing | Inquire |
| Cas | 487-24-1 |
| Molecular Weight | 268.26 |
| Molecular Formula | C16H12O4 |
| Canonical SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)O |