Esmolol Impurity 1
Esmolol Impurity 1 is an impurity of Esmolol. Esmolol is a cardioselective β-blocker which has a rapid onset but short duration of action without causing significant intrinsic sympathomimetic or membrane stabilizing activities at recommended therapeutic doses.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-135716 |
| Pricing | Inquire |
| Cas | 81147-94-6 |
| Molecular Weight | 236.26 |
| Molecular Formula | C13H16O4 |
| Canonical SMILES | COC(=O)CCC1=CC=C(C=C1)OCC2CO2 |